C14H21NO2S — CID 3769436
3,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 3769436) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | 3,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 3769436 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3,5-dimethyl-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C14H21NO2S/c1-11-4-6-14(7-5-11)18(16,17)15-9-12(2)8-13(3)10-15/h4-7,12-13H,8-10H2,1-3H3 |
| InChIKey | LUMUCYMSWPVTTJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |