C14H18NO4S- — CID 2049561
4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 2049561) has the molecular formula C14H18NO4S- and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2049561 |
| Molecular Formula | C14H18NO4S- |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(C(=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H19NO4S/c1-10-7-11(2)9-15(8-10)20(18,19)13-5-3-12(4-6-13)14(16)17/h3-6,10-11H,7-9H2,1-2H3,(H,16,17)/p-1/t10-,11-/m1/s1 |
| InChIKey | RDLUCWBSZMWQDA-GHMZBOCLSA-M |
| XLogP | 0.72 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |