C21H24FN3O4S — CID 18271490
N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-4-fluorobenzohydrazide (PubChem CID 18271490) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 18271490 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-4-fluorobenzohydrazide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)NNC(=O)c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C21H24FN3O4S/c1-14-11-15(2)13-25(12-14)30(28,29)19-9-5-17(6-10-19)21(27)24-23-20(26)16-3-7-18(22)8-4-16/h3-10,14-15H,11-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | DZIXEAZXSFQUFD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|