C21H25ClN4O4S — CID 153352350
N'-[(4-chlorobenzoyl)amino]-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzohydrazide (PubChem CID 153352350) has the molecular formula C21H25ClN4O4S and a molecular weight of 464.98 g/mol. Its IUPAC name is N'-[(4-chlorobenzoyl)amino]-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-[(4-chlorobenzoyl)amino]-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 153352350 |
| Molecular Formula | C21H25ClN4O4S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N'-[(4-chlorobenzoyl)amino]-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzohydrazide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)NNNC(=O)c3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C21H25ClN4O4S/c1-14-11-15(2)13-26(12-14)31(29,30)19-9-5-17(6-10-19)21(28)24-25-23-20(27)16-3-7-18(22)8-4-16/h3-10,14-15,25H,11-13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | AHWDGZCGBBTOKE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|