C19H30N4O3S2 — CID 9425553
1-tert-butyl-3-[[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoyl]amino]thiourea (PubChem CID 9425553) has the molecular formula C19H30N4O3S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425553 |
| Molecular Formula | C19H30N4O3S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-tert-butyl-3-[[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoyl]amino]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)NNC(=S)NC(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C19H30N4O3S2/c1-13-10-14(2)12-23(11-13)28(25,26)16-8-6-15(7-9-16)17(24)21-22-18(27)20-19(3,4)5/h6-9,13-14H,10-12H2,1-5H3,(H,21,24)(H2,20,22,27)/t13-,14-/m0/s1 |
| InChIKey | VFMJYDZPJMLMMM-KBPBESRZSA-N |
| XLogP | 2.26 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|