C17H27NO2S — CID 2950793
1-(4-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 2950793) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 2950793 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C17H27NO2S/c1-13-10-14(2)12-18(11-13)21(19,20)16-8-6-15(7-9-16)17(3,4)5/h6-9,13-14H,10-12H2,1-5H3 |
| InChIKey | UXRXBUNSLNSLSY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |