C28H36N4O6S2 — CID 91193182
(3R,5S)-1-[[7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-9,10-dinitroso-9,10-dihydroanthracen-2-yl]sulfonyl]-3,5-dimethylpiperidine (PubChem CID 91193182) has the molecular formula C28H36N4O6S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is (3R,5S)-1-[[7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-9,10-dinitroso-9,10-dihydroanthracen-2-yl]sulfonyl]-3,5-dimethylpiperidine.
| Compound Name | (3R,5S)-1-[[7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-9,10-dinitroso-9,10-dihydroanthracen-2-yl]sulfonyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 91193182 |
| Molecular Formula | C28H36N4O6S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (3R,5S)-1-[[7-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-9,10-dinitroso-9,10-dihydroanthracen-2-yl]sulfonyl]-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc3c(c2)C(N=O)c2cc(S(=O)(=O)N4C[C@H](C)C[C@H](C)C4)ccc2C3N=O)C1 |
| InChI | InChI=1S/C28H36N4O6S2/c1-17-9-18(2)14-31(13-17)39(35,36)21-5-7-23-25(11-21)28(30-34)26-12-22(6-8-24(26)27(23)29-33)40(37,38)32-15-19(3)10-20(4)16-32/h5-8,11-12,17-20,27-28H,9-10,13-16H2,1-4H3/t17-,18+,19-,20+,27?,28? |
| InChIKey | LQQUOMJXUXVPRB-IOTKHNBZSA-N |
| XLogP | 5.04 |
| TPSA | 133.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |