C14H21N3O4S — CID 9280658
4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroaniline (PubChem CID 9280658) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroaniline.
| Compound Name | 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroaniline |
|---|---|
| PubChem CID | 9280658 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-methyl-2-nitroaniline |
| SMILES | CNc1ccc(S(=O)(=O)N2C[C@H](C)C[C@H](C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O4S/c1-10-6-11(2)9-16(8-10)22(20,21)12-4-5-13(15-3)14(7-12)17(18)19/h4-5,7,10-11,15H,6,8-9H2,1-3H3/t10-,11+ |
| InChIKey | CBQPWFVKEUZLQW-PHIMTYICSA-N |
| XLogP | 2.30 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|