C20H24FN3O6S2 — CID 40975220
N-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-fluoro-3-methylbenzenesulfonamide (PubChem CID 40975220) has the molecular formula C20H24FN3O6S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-fluoro-3-methylbenzenesulfonamide.
| Compound Name | N-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 40975220 |
| Molecular Formula | C20H24FN3O6S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitrophenyl]-4-fluoro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)cc2[N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C20H24FN3O6S2/c1-13-8-14(2)12-23(11-13)32(29,30)17-5-7-19(20(10-17)24(25)26)22-31(27,28)16-4-6-18(21)15(3)9-16/h4-7,9-10,13-14,22H,8,11-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | CXUNFZQGGUNGSO-KBPBESRZSA-N |
| XLogP | 3.51 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|