C19H25N3O5S — CID 9026431
4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-[(1S)-1-(furan-2-yl)ethyl]-2-nitroaniline (PubChem CID 9026431) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-[(1S)-1-(furan-2-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-[(1S)-1-(furan-2-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 9026431 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-[(1S)-1-(furan-2-yl)ethyl]-2-nitroaniline |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(N[C@@H](C)c3ccco3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C19H25N3O5S/c1-13-9-14(2)12-21(11-13)28(25,26)16-6-7-17(18(10-16)22(23)24)20-15(3)19-5-4-8-27-19/h4-8,10,13-15,20H,9,11-12H2,1-3H3/t13-,14-,15+/m1/s1 |
| InChIKey | IWLVSIHAAIWKAZ-KFWWJZLASA-N |
| XLogP | 4.03 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|