C18H23N3O4S2 — CID 9111891
4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitro-N-(thiophen-2-ylmethyl)aniline (PubChem CID 9111891) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitro-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitro-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 9111891 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-2-nitro-N-(thiophen-2-ylmethyl)aniline |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NCc3cccs3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-13-8-14(2)12-20(11-13)27(24,25)16-5-6-17(18(9-16)21(22)23)19-10-15-4-3-7-26-15/h3-7,9,13-14,19H,8,10-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | IMCBOPQXQGCEBA-KBPBESRZSA-N |
| XLogP | 3.93 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|