C21H25N3O5S — CID 110824871
1-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(2-nitroanilino)ethanone (PubChem CID 110824871) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(2-nitroanilino)ethanone.
| Compound Name | 1-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(2-nitroanilino)ethanone |
|---|---|
| PubChem CID | 110824871 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 1-[3-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-2-(2-nitroanilino)ethanone |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)CNc3ccccc3[N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15-10-16(2)14-23(13-15)30(28,29)18-7-5-6-17(11-18)21(25)12-22-19-8-3-4-9-20(19)24(26)27/h3-9,11,15-16,22H,10,12-14H2,1-2H3 |
| InChIKey | RKJDYTUOQYXDEQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|