C20H23N3O5S — CID 55347661
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-nitrophenyl)benzamide (PubChem CID 55347661) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-nitrophenyl)benzamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 55347661 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-nitrophenyl)benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Nc3cccc([N+](=O)[O-])c3)c2)C1 |
| InChI | InChI=1S/C20H23N3O5S/c1-14-9-15(2)13-22(12-14)29(27,28)19-8-3-5-16(10-19)20(24)21-17-6-4-7-18(11-17)23(25)26/h3-8,10-11,14-15H,9,12-13H2,1-2H3,(H,21,24) |
| InChIKey | YUHQSEPMSBODOU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|