C23H26N4O3S — CID 55766235
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-pyrazol-1-ylphenyl)benzamide (PubChem CID 55766235) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-pyrazol-1-ylphenyl)benzamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-pyrazol-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55766235 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(3-pyrazol-1-ylphenyl)benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Nc3cccc(-n4cccn4)c3)c2)C1 |
| InChI | InChI=1S/C23H26N4O3S/c1-17-12-18(2)16-26(15-17)31(29,30)22-9-3-6-19(13-22)23(28)25-20-7-4-8-21(14-20)27-11-5-10-24-27/h3-11,13-14,17-18H,12,15-16H2,1-2H3,(H,25,28) |
| InChIKey | VMPUGADVQASNDW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |