C24H28N4O3S — CID 46424040
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(pyrazol-1-ylmethyl)phenyl]benzamide (PubChem CID 46424040) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(pyrazol-1-ylmethyl)phenyl]benzamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(pyrazol-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46424040 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[3-(pyrazol-1-ylmethyl)phenyl]benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Nc3cccc(Cn4cccn4)c3)c2)C1 |
| InChI | InChI=1S/C24H28N4O3S/c1-18-12-19(2)16-28(15-18)32(30,31)23-9-4-7-21(14-23)24(29)26-22-8-3-6-20(13-22)17-27-11-5-10-25-27/h3-11,13-14,18-19H,12,15-17H2,1-2H3,(H,26,29) |
| InChIKey | IOKAKNWQTSDCGA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |