C27H38N4O3S — CID 46644357
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide (PubChem CID 46644357) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide |
|---|---|
| PubChem CID | 46644357 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cccc(S(=O)(=O)N4CC(C)CC(C)C4)c3)cc2C)CC1 |
| InChI | InChI=1S/C27H38N4O3S/c1-5-29-11-13-30(14-12-29)26-10-9-24(16-22(26)4)28-27(32)23-7-6-8-25(17-23)35(33,34)31-18-20(2)15-21(3)19-31/h6-10,16-17,20-21H,5,11-15,18-19H2,1-4H3,(H,28,32) |
| InChIKey | SZRVLQGWUDMASQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|