C21H28N4O3S — CID 41478998
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-(methanesulfonamido)benzamide (PubChem CID 41478998) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 41478998 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-(methanesulfonamido)benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(NS(C)(=O)=O)cc3)cc2C)CC1 |
| InChI | InChI=1S/C21H28N4O3S/c1-4-24-11-13-25(14-12-24)20-10-9-19(15-16(20)2)22-21(26)17-5-7-18(8-6-17)23-29(3,27)28/h5-10,15,23H,4,11-14H2,1-3H3,(H,22,26) |
| InChIKey | PTYMNGVUKNIKJG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|