C26H33N5O3S — CID 24525567
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 24525567) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 24525567 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc4c(c3)S(=O)(=O)N=C3CCCCCN34)cc2C)CC1 |
| InChI | InChI=1S/C26H33N5O3S/c1-3-29-13-15-30(16-14-29)22-11-9-21(17-19(22)2)27-26(32)20-8-10-23-24(18-20)35(33,34)28-25-7-5-4-6-12-31(23)25/h8-11,17-18H,3-7,12-16H2,1-2H3,(H,27,32) |
| InChIKey | LJGCXUNQTYYCTB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|