C20H22N4O6S2 — CID 4844640
N-(4-methoxy-3-sulfamoylphenyl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 4844640) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 4844640 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2)S(=O)(=O)N=C2CCCCCN23)cc1S(N)(=O)=O |
| InChI | InChI=1S/C20H22N4O6S2/c1-30-16-9-7-14(12-18(16)31(21,26)27)22-20(25)13-6-8-15-17(11-13)32(28,29)23-19-5-3-2-4-10-24(15)19/h6-9,11-12H,2-5,10H2,1H3,(H,22,25)(H2,21,26,27) |
| InChIKey | WXBZOAACFOJURY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |