C12H12N4O4S — CID 115742535
N-(4-methoxy-3-sulfamoylphenyl)pyridazine-4-carboxamide (PubChem CID 115742535) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)pyridazine-4-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 115742535 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)pyridazine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnnc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H12N4O4S/c1-20-10-3-2-9(6-11(10)21(13,18)19)16-12(17)8-4-5-14-15-7-8/h2-7H,1H3,(H,16,17)(H2,13,18,19) |
| InChIKey | JYICNXYFNUUKJF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |