C10H11N5O4S — CID 112733236
N-(4-methoxy-3-sulfamoylphenyl)-2H-triazole-4-carboxamide (PubChem CID 112733236) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733236 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn[nH]n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11N5O4S/c1-19-8-3-2-6(4-9(8)20(11,17)18)13-10(16)7-5-12-15-14-7/h2-5H,1H3,(H,13,16)(H2,11,17,18)(H,12,14,15) |
| InChIKey | ROHAECCYJGCDDN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |