C17H15N3O4S — CID 4789220
N-(4-methoxy-3-sulfamoylphenyl)quinoline-2-carboxamide (PubChem CID 4789220) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)quinoline-2-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4789220 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)quinoline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3ccccc3n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H15N3O4S/c1-24-15-9-7-12(10-16(15)25(18,22)23)19-17(21)14-8-6-11-4-2-3-5-13(11)20-14/h2-10H,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | DTEMUADBXUTSTK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |