C10H10N4O4S2 — CID 61068916
N-(4-methoxy-3-sulfamoylphenyl)thiadiazole-4-carboxamide (PubChem CID 61068916) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 61068916 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)thiadiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csnn2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10N4O4S2/c1-18-8-3-2-6(4-9(8)20(11,16)17)12-10(15)7-5-19-14-13-7/h2-5H,1H3,(H,12,15)(H2,11,16,17) |
| InChIKey | VIYQVCXDQQPHTQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |