C13H15N3O4S — CID 60631248
N-(4-methoxy-3-sulfamoylphenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 60631248) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60631248 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccn2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H15N3O4S/c1-16-7-3-4-10(16)13(17)15-9-5-6-11(20-2)12(8-9)21(14,18)19/h3-8H,1-2H3,(H,15,17)(H2,14,18,19) |
| InChIKey | ADSPLCWIAOBQGS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |