C14H12Cl2N2O4S — CID 26929610
3,5-dichloro-N-(4-methoxy-3-sulfamoylphenyl)benzamide (PubChem CID 26929610) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-methoxy-3-sulfamoylphenyl)benzamide.
| Compound Name | 3,5-dichloro-N-(4-methoxy-3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 26929610 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 3,5-dichloro-N-(4-methoxy-3-sulfamoylphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(Cl)cc(Cl)c2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H12Cl2N2O4S/c1-22-12-3-2-11(7-13(12)23(17,20)21)18-14(19)8-4-9(15)6-10(16)5-8/h2-7H,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | YDUDGQADQVGGJO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |