C16H18N2O4S — CID 36704961
N-(3,5-dimethylphenyl)-4-methoxy-3-sulfamoylbenzamide (PubChem CID 36704961) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-methoxy-3-sulfamoylbenzamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-methoxy-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 36704961 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-methoxy-3-sulfamoylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C)cc(C)c2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H18N2O4S/c1-10-6-11(2)8-13(7-10)18-16(19)12-4-5-14(22-3)15(9-12)23(17,20)21/h4-9H,1-3H3,(H,18,19)(H2,17,20,21) |
| InChIKey | YGBDABGFZJLRBF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |