C17H19BrN2O3S — CID 26409361
4-bromo-N-(3,5-dimethylphenyl)-3-(dimethylsulfamoyl)benzamide (PubChem CID 26409361) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 4-bromo-N-(3,5-dimethylphenyl)-3-(dimethylsulfamoyl)benzamide.
| Compound Name | 4-bromo-N-(3,5-dimethylphenyl)-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26409361 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-bromo-N-(3,5-dimethylphenyl)-3-(dimethylsulfamoyl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C17H19BrN2O3S/c1-11-7-12(2)9-14(8-11)19-17(21)13-5-6-15(18)16(10-13)24(22,23)20(3)4/h5-10H,1-4H3,(H,19,21) |
| InChIKey | RKALIKCAQDLGAS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |