C20H20BrN3O5S — CID 55706130
4-bromo-3-(dimethylsulfamoyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]benzamide (PubChem CID 55706130) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]benzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55706130 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(N3C(=O)CCCC3=O)cc2)ccc1Br |
| InChI | InChI=1S/C20H20BrN3O5S/c1-23(2)30(28,29)17-12-13(6-11-16(17)21)20(27)22-14-7-9-15(10-8-14)24-18(25)4-3-5-19(24)26/h6-12H,3-5H2,1-2H3,(H,22,27) |
| InChIKey | PEDDAXFGMSZAEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|