C11H15BrN2O3S — CID 43011499
4-bromo-3-(dimethylsulfamoyl)-N,N-dimethylbenzamide (PubChem CID 43011499) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N,N-dimethylbenzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 43011499 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Br)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C11H15BrN2O3S/c1-13(2)11(15)8-5-6-9(12)10(7-8)18(16,17)14(3)4/h5-7H,1-4H3 |
| InChIKey | AUNHKHBFUFAIPI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |