C15H22BrN3O4S — CID 9476078
4-bromo-3-(dimethylsulfamoyl)-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 9476078) has the molecular formula C15H22BrN3O4S and a molecular weight of 420.33 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 9476078 |
| Molecular Formula | C15H22BrN3O4S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)c1ccc(Br)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H22BrN3O4S/c1-10(2)17-14(20)9-19(5)15(21)11-6-7-12(16)13(8-11)24(22,23)18(3)4/h6-8,10H,9H2,1-5H3,(H,17,20) |
| InChIKey | YLIIVEJHXJVQCH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |