C15H23BrN2O5S — CID 43010416
4-bromo-3-(dimethylsulfamoyl)-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 43010416) has the molecular formula C15H23BrN2O5S and a molecular weight of 423.33 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 43010416 |
| Molecular Formula | C15H23BrN2O5S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1ccc(Br)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H23BrN2O5S/c1-17(2)24(20,21)14-11-12(5-6-13(14)16)15(19)18(7-9-22-3)8-10-23-4/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | CNYYZJMOKZNUEY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |