C21H27BrN2O5S — CID 24655936
4-bromo-3-(dimethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide (PubChem CID 24655936) has the molecular formula C21H27BrN2O5S and a molecular weight of 499.43 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 24655936 |
| Molecular Formula | C21H27BrN2O5S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide |
| SMILES | CCOc1ccc(CN(CC)C(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)cc1OC |
| InChI | InChI=1S/C21H27BrN2O5S/c1-6-24(14-15-8-11-18(29-7-2)19(12-15)28-5)21(25)16-9-10-17(22)20(13-16)30(26,27)23(3)4/h8-13H,6-7,14H2,1-5H3 |
| InChIKey | RRMMCOZSNOXPBW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |