C23H32N2O5S — CID 24548544
4-(diethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide (PubChem CID 24548544) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 24548544 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[(4-ethoxy-3-methoxyphenyl)methyl]-N-ethylbenzamide |
| SMILES | CCOc1ccc(CN(CC)C(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)cc1OC |
| InChI | InChI=1S/C23H32N2O5S/c1-6-24(17-18-10-15-21(30-9-4)22(16-18)29-5)23(26)19-11-13-20(14-12-19)31(27,28)25(7-2)8-3/h10-16H,6-9,17H2,1-5H3 |
| InChIKey | MJILVGIISAACKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |