C26H30N2O5S — CID 24513203
3-(dimethylsulfamoyl)-N-ethyl-4-methoxy-N-[(4-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 24513203) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-ethyl-4-methoxy-N-[(4-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-ethyl-4-methoxy-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24513203 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-ethyl-4-methoxy-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | CCN(Cc1ccc(OCc2ccccc2)cc1)C(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-28(18-20-11-14-23(15-12-20)33-19-21-9-7-6-8-10-21)26(29)22-13-16-24(32-4)25(17-22)34(30,31)27(2)3/h6-17H,5,18-19H2,1-4H3 |
| InChIKey | FQOYNTUEFKHIAN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |