C25H26N2O4 — CID 27741024
N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-4-phenylmethoxybenzamide (PubChem CID 27741024) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-4-phenylmethoxybenzamide.
| Compound Name | N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 27741024 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-4-phenylmethoxybenzamide |
| SMILES | CCN(CC(=O)Nc1ccccc1OC)C(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-3-27(17-24(28)26-22-11-7-8-12-23(22)30-2)25(29)20-13-15-21(16-14-20)31-18-19-9-5-4-6-10-19/h4-16H,3,17-18H2,1-2H3,(H,26,28) |
| InChIKey | PRJPVDFIYLRWIB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |