C24H22Cl2N2O3 — CID 27744494
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4-phenylmethoxybenzamide (PubChem CID 27744494) has the molecular formula C24H22Cl2N2O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4-phenylmethoxybenzamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 27744494 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4-phenylmethoxybenzamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-2-28(15-22(29)27-23-20(25)9-6-10-21(23)26)24(30)18-11-13-19(14-12-18)31-16-17-7-4-3-5-8-17/h3-14H,2,15-16H2,1H3,(H,27,29) |
| InChIKey | FSXOJLPBZSBEBY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |