C21H24Cl2N2O2 — CID 25313738
4-tert-butyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide (PubChem CID 25313738) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide.
| Compound Name | 4-tert-butyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 25313738 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-tert-butyl-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-5-25(13-18(26)24-19-16(22)7-6-8-17(19)23)20(27)14-9-11-15(12-10-14)21(2,3)4/h6-12H,5,13H2,1-4H3,(H,24,26) |
| InChIKey | WDYFDDUIYWECRO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |