C17H15BrCl2N2O2 — CID 34169565
2-bromo-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide (PubChem CID 34169565) has the molecular formula C17H15BrCl2N2O2 and a molecular weight of 430.13 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide.
| Compound Name | 2-bromo-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 34169565 |
| Molecular Formula | C17H15BrCl2N2O2 |
| Molecular Weight | 430.13 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 2-bromo-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylbenzamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H15BrCl2N2O2/c1-2-22(17(24)11-6-3-4-7-12(11)18)10-15(23)21-16-13(19)8-5-9-14(16)20/h3-9H,2,10H2,1H3,(H,21,23) |
| InChIKey | CPOFBVDNTFYCTM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.13 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |