C17H14Cl2F2N2O2 — CID 38369368
2,5-dichloro-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylbenzamide (PubChem CID 38369368) has the molecular formula C17H14Cl2F2N2O2 and a molecular weight of 387.21 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylbenzamide.
| Compound Name | 2,5-dichloro-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 38369368 |
| Molecular Formula | C17H14Cl2F2N2O2 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2,5-dichloro-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylbenzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2F2N2O2/c1-2-23(17(25)11-8-10(18)6-7-12(11)19)9-15(24)22-16-13(20)4-3-5-14(16)21/h3-8H,2,9H2,1H3,(H,22,24) |
| InChIKey | YQGYNNRUQJRDNL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |