C12H14F2N2O2 — CID 55100293
N-ethyl-2,3-difluoro-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 55100293) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is N-ethyl-2,3-difluoro-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | N-ethyl-2,3-difluoro-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55100293 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-ethyl-2,3-difluoro-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)NC)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H14F2N2O2/c1-3-16(7-10(17)15-2)12(18)8-5-4-6-9(13)11(8)14/h4-6H,3,7H2,1-2H3,(H,15,17) |
| InChIKey | UUKCYAPPMMTLQG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |