C14H12BrF2NOS — CID 62649246
N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-2,3-difluorobenzamide (PubChem CID 62649246) has the molecular formula C14H12BrF2NOS and a molecular weight of 360.22 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-2,3-difluorobenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62649246 |
| Molecular Formula | C14H12BrF2NOS |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-2,3-difluorobenzamide |
| SMILES | CCN(Cc1ccc(Br)s1)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C14H12BrF2NOS/c1-2-18(8-9-6-7-12(15)20-9)14(19)10-4-3-5-11(16)13(10)17/h3-7H,2,8H2,1H3 |
| InChIKey | JXBAAIFEJHQYLO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |