C11H12F2N2O2 — CID 103101747
N-(2-amino-2-oxoethyl)-N-ethyl-2,3-difluorobenzamide (PubChem CID 103101747) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-ethyl-2,3-difluorobenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-ethyl-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 103101747 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-ethyl-2,3-difluorobenzamide |
| SMILES | CCN(CC(N)=O)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H12F2N2O2/c1-2-15(6-9(14)16)11(17)7-4-3-5-8(12)10(7)13/h3-5H,2,6H2,1H3,(H2,14,16) |
| InChIKey | FJRBSUMJQHIUQP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |