C12H16FNO — CID 80718588
N,N-diethyl-2-fluoro-3-methylbenzamide (PubChem CID 80718588) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is N,N-diethyl-2-fluoro-3-methylbenzamide.
| Compound Name | N,N-diethyl-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 80718588 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N,N-diethyl-2-fluoro-3-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(C)c1F |
| InChI | InChI=1S/C12H16FNO/c1-4-14(5-2)12(15)10-8-6-7-9(3)11(10)13/h6-8H,4-5H2,1-3H3 |
| InChIKey | AHLJNZZFUIUIQK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |