C11H13ClFNO — CID 80949009
3-chloro-N,N-diethyl-2-fluorobenzamide (PubChem CID 80949009) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-2-fluorobenzamide.
| Compound Name | 3-chloro-N,N-diethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 80949009 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-chloro-N,N-diethyl-2-fluorobenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H13ClFNO/c1-3-14(4-2)11(15)8-6-5-7-9(12)10(8)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | GCFSOKIZTPALHK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |