C11H13BrClNO — CID 103975185
3-bromo-2-chloro-N,N-diethylbenzamide (PubChem CID 103975185) has the molecular formula C11H13BrClNO and a molecular weight of 290.59 g/mol. Its IUPAC name is 3-bromo-2-chloro-N,N-diethylbenzamide.
| Compound Name | 3-bromo-2-chloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 103975185 |
| Molecular Formula | C11H13BrClNO |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-bromo-2-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C11H13BrClNO/c1-3-14(4-2)11(15)8-6-5-7-9(12)10(8)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | YXYGTLGPEBMAEV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |