C15H16ClNO — CID 50850160
5-chloro-N,N-diethylnaphthalene-1-carboxamide (PubChem CID 50850160) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 5-chloro-N,N-diethylnaphthalene-1-carboxamide.
| Compound Name | 5-chloro-N,N-diethylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 50850160 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-chloro-N,N-diethylnaphthalene-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C15H16ClNO/c1-3-17(4-2)15(18)13-9-5-8-12-11(13)7-6-10-14(12)16/h5-10H,3-4H2,1-2H3 |
| InChIKey | HPTBGUNKHRSJLW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |