C14H15ClN2O — CID 106765835
1-chloro-N,N-diethylisoquinoline-4-carboxamide (PubChem CID 106765835) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 1-chloro-N,N-diethylisoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N,N-diethylisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106765835 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-chloro-N,N-diethylisoquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H15ClN2O/c1-3-17(4-2)14(18)12-9-16-13(15)11-8-6-5-7-10(11)12/h5-9H,3-4H2,1-2H3 |
| InChIKey | RPLGVNHNWUXJRP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|