C13H10ClF3N2O — CID 106765986
1-chloro-N-methyl-N-(2,2,2-trifluoroethyl)isoquinoline-4-carboxamide (PubChem CID 106765986) has the molecular formula C13H10ClF3N2O and a molecular weight of 302.68 g/mol. Its IUPAC name is 1-chloro-N-methyl-N-(2,2,2-trifluoroethyl)isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-methyl-N-(2,2,2-trifluoroethyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106765986 |
| Molecular Formula | C13H10ClF3N2O |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-chloro-N-methyl-N-(2,2,2-trifluoroethyl)isoquinoline-4-carboxamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C13H10ClF3N2O/c1-19(7-13(15,16)17)12(20)10-6-18-11(14)9-5-3-2-4-8(9)10/h2-6H,7H2,1H3 |
| InChIKey | CYIDAYLAJUDSKG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|