C14H12ClF3N2O — CID 106766302
1-chloro-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide (PubChem CID 106766302) has the molecular formula C14H12ClF3N2O and a molecular weight of 316.71 g/mol. Its IUPAC name is 1-chloro-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide.
| Compound Name | 1-chloro-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106766302 |
| Molecular Formula | C14H12ClF3N2O |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-chloro-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H12ClF3N2O/c15-12-10-5-2-1-4-9(10)11(8-20-12)13(21)19-7-3-6-14(16,17)18/h1-2,4-5,8H,3,6-7H2,(H,19,21) |
| InChIKey | QTOQIADDVLXJQR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|