C14H14F3N3O — CID 106772541
1-amino-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide (PubChem CID 106772541) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-amino-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide.
| Compound Name | 1-amino-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106772541 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-amino-N-(4,4,4-trifluorobutyl)isoquinoline-4-carboxamide |
| SMILES | Nc1ncc(C(=O)NCCCC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)6-3-7-19-13(21)11-8-20-12(18)10-5-2-1-4-9(10)11/h1-2,4-5,8H,3,6-7H2,(H2,18,20)(H,19,21) |
| InChIKey | KQKBTRGIEZROHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|